C25H35NO2 — CID 145118967
[(3S)-1-cyclobutylpiperidin-3-yl]-(5-ethyl-6-methoxynaphthalen-2-yl)methanone;ethane (PubChem CID 145118967) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is [(3S)-1-cyclobutylpiperidin-3-yl]-(5-ethyl-6-methoxynaphthalen-2-yl)methanone;ethane.
| Compound Name | [(3S)-1-cyclobutylpiperidin-3-yl]-(5-ethyl-6-methoxynaphthalen-2-yl)methanone;ethane |
|---|---|
| PubChem CID | 145118967 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | [(3S)-1-cyclobutylpiperidin-3-yl]-(5-ethyl-6-methoxynaphthalen-2-yl)methanone;ethane |
| SMILES | CC.CCc1c(OC)ccc2cc(C(=O)[C@H]3CCCN(C4CCC4)C3)ccc12 |
| InChI | InChI=1S/C23H29NO2.C2H6/c1-3-20-21-11-9-17(14-16(21)10-12-22(20)26-2)23(25)18-6-5-13-24(15-18)19-7-4-8-19;1-2/h9-12,14,18-19H,3-8,13,15H2,1-2H3;1-2H3/t18-;/m0./s1 |
| InChIKey | CRWXURDGKTVPDB-FERBBOLQSA-N |
| XLogP | 5.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |