C20H22BrNO — CID 121479163
(6-bromonaphthalen-2-yl)-[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]methanone (PubChem CID 121479163) has the molecular formula C20H22BrNO and a molecular weight of 372.31 g/mol. Its IUPAC name is (6-bromonaphthalen-2-yl)-[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]methanone.
| Compound Name | (6-bromonaphthalen-2-yl)-[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 121479163 |
| Molecular Formula | C20H22BrNO |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (6-bromonaphthalen-2-yl)-[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc2cc(Br)ccc2c1)[C@@H]1CCCN(CC2CC2)C1 |
| InChI | InChI=1S/C20H22BrNO/c21-19-8-7-15-10-17(6-5-16(15)11-19)20(23)18-2-1-9-22(13-18)12-14-3-4-14/h5-8,10-11,14,18H,1-4,9,12-13H2/t18-/m1/s1 |
| InChIKey | XPCWZTUROPZJHV-GOSISDBHSA-N |
| XLogP | 4.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |