C23H29NO — CID 134203310
[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methanone (PubChem CID 134203310) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is [(3R)-1-(cyclopropylmethyl)piperidin-3-yl]-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methanone.
| Compound Name | [(3R)-1-(cyclopropylmethyl)piperidin-3-yl]-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 134203310 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | [(3R)-1-(cyclopropylmethyl)piperidin-3-yl]-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methanone |
| SMILES | C=C/C=C\C=C(/C)c1ccc(C(=O)[C@@H]2CCCN(CC3CC3)C2)cc1 |
| InChI | InChI=1S/C23H29NO/c1-3-4-5-7-18(2)20-11-13-21(14-12-20)23(25)22-8-6-15-24(17-22)16-19-9-10-19/h3-5,7,11-14,19,22H,1,6,8-10,15-17H2,2H3/b5-4-,18-7+/t22-/m1/s1 |
| InChIKey | MXTXKBQQSJGMPE-ZWWZXQGUSA-N |
| XLogP | 5.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|