C17H23ClN2O2 — CID 74379261
2-[1-(6-methoxynaphthalen-2-yl)ethylideneamino]oxy-N,N-dimethylethanamine;hydrochloride (PubChem CID 74379261) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-[1-(6-methoxynaphthalen-2-yl)ethylideneamino]oxy-N,N-dimethylethanamine;hydrochloride.
| Compound Name | 2-[1-(6-methoxynaphthalen-2-yl)ethylideneamino]oxy-N,N-dimethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 74379261 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[1-(6-methoxynaphthalen-2-yl)ethylideneamino]oxy-N,N-dimethylethanamine;hydrochloride |
| SMILES | COc1ccc2cc(C(C)=NOCCN(C)C)ccc2c1.Cl |
| InChI | InChI=1S/C17H22N2O2.ClH/c1-13(18-21-10-9-19(2)3)14-5-6-16-12-17(20-4)8-7-15(16)11-14;/h5-8,11-12H,9-10H2,1-4H3;1H |
| InChIKey | QDAGMTUADQGMGH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|