C17H24N2O5 — CID 87578431
4-[2-[1-(4-methoxyphenyl)ethylideneamino]oxyethoxy]piperidine-1-carboxylic acid (PubChem CID 87578431) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[2-[1-(4-methoxyphenyl)ethylideneamino]oxyethoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-[1-(4-methoxyphenyl)ethylideneamino]oxyethoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87578431 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[2-[1-(4-methoxyphenyl)ethylideneamino]oxyethoxy]piperidine-1-carboxylic acid |
| SMILES | COc1ccc(C(C)=NOCCOC2CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C17H24N2O5/c1-13(14-3-5-15(22-2)6-4-14)18-24-12-11-23-16-7-9-19(10-8-16)17(20)21/h3-6,16H,7-12H2,1-2H3,(H,20,21) |
| InChIKey | SNNICSZAFILMME-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|