C21H29F3N2O4 — CID 74974822
tert-butyl 4-[2-[1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxyethoxy]piperidine-1-carboxylate (PubChem CID 74974822) has the molecular formula C21H29F3N2O4 and a molecular weight of 430.47 g/mol. Its IUPAC name is tert-butyl 4-[2-[1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxyethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxyethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 74974822 |
| Molecular Formula | C21H29F3N2O4 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | tert-butyl 4-[2-[1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxyethoxy]piperidine-1-carboxylate |
| SMILES | CC(=NOCCOC1CCN(C(=O)OC(C)(C)C)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H29F3N2O4/c1-15(16-5-7-17(8-6-16)21(22,23)24)25-29-14-13-28-18-9-11-26(12-10-18)19(27)30-20(2,3)4/h5-8,18H,9-14H2,1-4H3 |
| InChIKey | XZGBUFSBTCAMQN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|