C11H12F3NO2 — CID 173297287
2-[1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxyethanol (PubChem CID 173297287) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-[1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxyethanol.
| Compound Name | 2-[1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxyethanol |
|---|---|
| PubChem CID | 173297287 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-[1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxyethanol |
| SMILES | CC(=NOCCO)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO2/c1-8(15-17-7-6-16)9-2-4-10(5-3-9)11(12,13)14/h2-5,16H,6-7H2,1H3 |
| InChIKey | TXGJGBWQPRPXSV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|