C20H31ClN2O4 — CID 119662784
1-[4-(3-aminopropoxy)piperidin-1-yl]-5-(4-methoxyphenyl)pentane-1,5-dione;hydrochloride (PubChem CID 119662784) has the molecular formula C20H31ClN2O4 and a molecular weight of 398.93 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-5-(4-methoxyphenyl)pentane-1,5-dione;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-5-(4-methoxyphenyl)pentane-1,5-dione;hydrochloride |
|---|---|
| PubChem CID | 119662784 |
| Molecular Formula | C20H31ClN2O4 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-5-(4-methoxyphenyl)pentane-1,5-dione;hydrochloride |
| SMILES | COc1ccc(C(=O)CCCC(=O)N2CCC(OCCCN)CC2)cc1.Cl |
| InChI | InChI=1S/C20H30N2O4.ClH/c1-25-17-8-6-16(7-9-17)19(23)4-2-5-20(24)22-13-10-18(11-14-22)26-15-3-12-21;/h6-9,18H,2-5,10-15,21H2,1H3;1H |
| InChIKey | LYGRPXHYLSIOMU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|