C29H25N5O5 — CID 6276719
9-(4-methoxyphenyl)-13-[[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaen-5-ol (PubChem CID 6276719) has the molecular formula C29H25N5O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-13-[[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaen-5-ol.
| Compound Name | 9-(4-methoxyphenyl)-13-[[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaen-5-ol |
|---|---|
| PubChem CID | 6276719 |
| Molecular Formula | C29H25N5O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 9-(4-methoxyphenyl)-13-[[(Z)-1-(4-methoxyphenyl)ethylideneamino]oxymethyl]-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaen-5-ol |
| SMILES | COc1ccc(/C(C)=N\OCc2nc3c4c(ncn3n2)Oc2cc(O)ccc2C4c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H25N5O5/c1-17(18-4-9-21(36-2)10-5-18)33-38-15-25-31-28-27-26(19-6-11-22(37-3)12-7-19)23-13-8-20(35)14-24(23)39-29(27)30-16-34(28)32-25/h4-14,16,26,35H,15H2,1-3H3/b33-17- |
| InChIKey | SUFPNNNNICLNGG-FZPRHHONSA-N |
| XLogP | 5.07 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|