C19H13ClN4O2 — CID 71570051
9-(4-chlorophenyl)-5-methoxy-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaene (PubChem CID 71570051) has the molecular formula C19H13ClN4O2 and a molecular weight of 364.79 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-5-methoxy-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaene.
| Compound Name | 9-(4-chlorophenyl)-5-methoxy-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaene |
|---|---|
| PubChem CID | 71570051 |
| Molecular Formula | C19H13ClN4O2 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 9-(4-chlorophenyl)-5-methoxy-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11,13,16-heptaene |
| SMILES | COc1ccc2c(c1)Oc1ncn3ncnc3c1C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClN4O2/c1-25-13-6-7-14-15(8-13)26-19-17(18-21-9-23-24(18)10-22-19)16(14)11-2-4-12(20)5-3-11/h2-10,16H,1H3 |
| InChIKey | LIOXBHQTYGWZNI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |