C20H18ClN3O2 — CID 71569901
5-(4-chlorophenyl)-8-ethoxy-3-methyl-5H-chromeno[2,3-d]pyrimidin-4-imine (PubChem CID 71569901) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-8-ethoxy-3-methyl-5H-chromeno[2,3-d]pyrimidin-4-imine.
| Compound Name | 5-(4-chlorophenyl)-8-ethoxy-3-methyl-5H-chromeno[2,3-d]pyrimidin-4-imine |
|---|---|
| PubChem CID | 71569901 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-(4-chlorophenyl)-8-ethoxy-3-methyl-5H-chromeno[2,3-d]pyrimidin-4-imine |
| SMILES | [H]/N=c1/c2c(ncn1C)Oc1cc(OCC)ccc1C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O2/c1-3-25-14-8-9-15-16(10-14)26-20-18(19(22)24(2)11-23-20)17(15)12-4-6-13(21)7-5-12/h4-11,17,22H,3H2,1-2H3/b22-19- |
| InChIKey | ZRTMBHFAZLCRRD-QOCHGBHMSA-N |
| XLogP | 4.24 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |