C19H17N3O3 — CID 98173173
(5S)-3-(2-hydroxyethyl)-4-imino-5-phenyl-5H-chromeno[2,3-d]pyrimidin-8-ol (PubChem CID 98173173) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (5S)-3-(2-hydroxyethyl)-4-imino-5-phenyl-5H-chromeno[2,3-d]pyrimidin-8-ol.
| Compound Name | (5S)-3-(2-hydroxyethyl)-4-imino-5-phenyl-5H-chromeno[2,3-d]pyrimidin-8-ol |
|---|---|
| PubChem CID | 98173173 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (5S)-3-(2-hydroxyethyl)-4-imino-5-phenyl-5H-chromeno[2,3-d]pyrimidin-8-ol |
| SMILES | [H]/N=c1/c2c(ncn1CCO)Oc1cc(O)ccc1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C19H17N3O3/c20-18-17-16(12-4-2-1-3-5-12)14-7-6-13(24)10-15(14)25-19(17)21-11-22(18)8-9-23/h1-7,10-11,16,20,23-24H,8-9H2/b20-18-/t16-/m0/s1 |
| InChIKey | RYYHGLMILQQEME-MXLIYFDZSA-N |
| XLogP | 2.35 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |