C24H23N5O2 — CID 3749665
3-(10-imino-6-methyl-4,8-diphenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-11-yl)propan-1-ol (PubChem CID 3749665) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-(10-imino-6-methyl-4,8-diphenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-11-yl)propan-1-ol.
| Compound Name | 3-(10-imino-6-methyl-4,8-diphenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-11-yl)propan-1-ol |
|---|---|
| PubChem CID | 3749665 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 3-(10-imino-6-methyl-4,8-diphenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-11-yl)propan-1-ol |
| SMILES | [H]/N=c1/c2c(ncn1CCCO)Oc1c(c(C)nn1-c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C24H23N5O2/c1-16-19-20(17-9-4-2-5-10-17)21-22(25)28(13-8-14-30)15-26-23(21)31-24(19)29(27-16)18-11-6-3-7-12-18/h2-7,9-12,15,20,25,30H,8,13-14H2,1H3/b25-22- |
| InChIKey | VADSHQMYXMKERM-LVWGJNHUSA-N |
| XLogP | 3.52 |
| TPSA | 88.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |