C27H25N7O — CID 4993587
11-(3-imidazol-1-ylpropyl)-6-methyl-4,8-diphenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-10-imine (PubChem CID 4993587) has the molecular formula C27H25N7O and a molecular weight of 463.55 g/mol. Its IUPAC name is 11-(3-imidazol-1-ylpropyl)-6-methyl-4,8-diphenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-10-imine.
| Compound Name | 11-(3-imidazol-1-ylpropyl)-6-methyl-4,8-diphenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-10-imine |
|---|---|
| PubChem CID | 4993587 |
| Molecular Formula | C27H25N7O |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 11-(3-imidazol-1-ylpropyl)-6-methyl-4,8-diphenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-10-imine |
| SMILES | [H]/N=c1/c2c(ncn1CCCn1ccnc1)Oc1c(c(C)nn1-c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C27H25N7O/c1-19-22-23(20-9-4-2-5-10-20)24-25(28)33(15-8-14-32-16-13-29-17-32)18-30-26(24)35-27(22)34(31-19)21-11-6-3-7-12-21/h2-7,9-13,16-18,23,28H,8,14-15H2,1H3/b28-25- |
| InChIKey | AGJVRNOKTCFGKE-FVDSYPCUSA-N |
| XLogP | 4.43 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |