C29H25N5O2 — CID 98169026
(8R)-11-benzyl-8-(4-methoxyphenyl)-6-methyl-4-phenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-10-imine (PubChem CID 98169026) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is (8R)-11-benzyl-8-(4-methoxyphenyl)-6-methyl-4-phenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-10-imine.
| Compound Name | (8R)-11-benzyl-8-(4-methoxyphenyl)-6-methyl-4-phenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-10-imine |
|---|---|
| PubChem CID | 98169026 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (8R)-11-benzyl-8-(4-methoxyphenyl)-6-methyl-4-phenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5,12-tetraen-10-imine |
| SMILES | [H]/N=c1/c2c(ncn1Cc1ccccc1)Oc1c(c(C)nn1-c1ccccc1)[C@H]2c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H25N5O2/c1-19-24-25(21-13-15-23(35-2)16-14-21)26-27(30)33(17-20-9-5-3-6-10-20)18-31-28(26)36-29(24)34(32-19)22-11-7-4-8-12-22/h3-16,18,25,30H,17H2,1-2H3/b30-27-/t25-/m1/s1 |
| InChIKey | MNCUBDLRZUGKDA-JGIWYWAVSA-N |
| XLogP | 5.20 |
| TPSA | 77.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |