C20H20N4O2 — CID 4971886
3-butyl-4-imino-5-pyridin-3-yl-5H-chromeno[2,3-d]pyrimidin-8-ol (PubChem CID 4971886) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-butyl-4-imino-5-pyridin-3-yl-5H-chromeno[2,3-d]pyrimidin-8-ol.
| Compound Name | 3-butyl-4-imino-5-pyridin-3-yl-5H-chromeno[2,3-d]pyrimidin-8-ol |
|---|---|
| PubChem CID | 4971886 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-butyl-4-imino-5-pyridin-3-yl-5H-chromeno[2,3-d]pyrimidin-8-ol |
| SMILES | [H]/N=c1/c2c(ncn1CCCC)Oc1cc(O)ccc1C2c1cccnc1 |
| InChI | InChI=1S/C20H20N4O2/c1-2-3-9-24-12-23-20-18(19(24)21)17(13-5-4-8-22-11-13)15-7-6-14(25)10-16(15)26-20/h4-8,10-12,17,21,25H,2-3,9H2,1H3/b21-19- |
| InChIKey | IDSVDMRCJOMHHI-VZCXRCSSSA-N |
| XLogP | 3.55 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |