C10H9Cl3N2 — CID 529810
N-(but-3-en-2-ylideneamino)-2,4,6-trichloroaniline (PubChem CID 529810) has the molecular formula C10H9Cl3N2 and a molecular weight of 263.56 g/mol. Its IUPAC name is N-(but-3-en-2-ylideneamino)-2,4,6-trichloroaniline.
| Compound Name | N-(but-3-en-2-ylideneamino)-2,4,6-trichloroaniline |
|---|---|
| PubChem CID | 529810 |
| Molecular Formula | C10H9Cl3N2 |
| Molecular Weight | 263.56 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | N-(but-3-en-2-ylideneamino)-2,4,6-trichloroaniline |
| SMILES | C=CC(C)=NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl3N2/c1-3-6(2)14-15-10-8(12)4-7(11)5-9(10)13/h3-5,15H,1H2,2H3 |
| InChIKey | BJJTWQXFVOJVKR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|