C13H10Cl3N3 — CID 5006880
2,4,6-trichloro-N-(1-pyridin-4-ylethylideneamino)aniline (PubChem CID 5006880) has the molecular formula C13H10Cl3N3 and a molecular weight of 314.60 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(1-pyridin-4-ylethylideneamino)aniline.
| Compound Name | 2,4,6-trichloro-N-(1-pyridin-4-ylethylideneamino)aniline |
|---|---|
| PubChem CID | 5006880 |
| Molecular Formula | C13H10Cl3N3 |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2,4,6-trichloro-N-(1-pyridin-4-ylethylideneamino)aniline |
| SMILES | CC(=NNc1c(Cl)cc(Cl)cc1Cl)c1ccncc1 |
| InChI | InChI=1S/C13H10Cl3N3/c1-8(9-2-4-17-5-3-9)18-19-13-11(15)6-10(14)7-12(13)16/h2-7,19H,1H3 |
| InChIKey | OGMOKAVOORRFRO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|