C15H17N3 — CID 6176920
2,3-dimethyl-N-[(Z)-1-pyridin-4-ylethylideneamino]aniline (PubChem CID 6176920) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(Z)-1-pyridin-4-ylethylideneamino]aniline.
| Compound Name | 2,3-dimethyl-N-[(Z)-1-pyridin-4-ylethylideneamino]aniline |
|---|---|
| PubChem CID | 6176920 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2,3-dimethyl-N-[(Z)-1-pyridin-4-ylethylideneamino]aniline |
| SMILES | C/C(=N/Nc1cccc(C)c1C)c1ccncc1 |
| InChI | InChI=1S/C15H17N3/c1-11-5-4-6-15(12(11)2)18-17-13(3)14-7-9-16-10-8-14/h4-10,18H,1-3H3/b17-13- |
| InChIKey | HKWZBVQNYPJNBT-LGMDPLHJSA-N |
| XLogP | 3.53 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|