C21H20BrClN2 — CID 146061297
N-[(E)-[(4-bromophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline;hydrochloride (PubChem CID 146061297) has the molecular formula C21H20BrClN2 and a molecular weight of 415.76 g/mol. Its IUPAC name is N-[(E)-[(4-bromophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline;hydrochloride.
| Compound Name | N-[(E)-[(4-bromophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline;hydrochloride |
|---|---|
| PubChem CID | 146061297 |
| Molecular Formula | C21H20BrClN2 |
| Molecular Weight | 415.76 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N-[(E)-[(4-bromophenyl)-phenylmethylidene]amino]-2,3-dimethylaniline;hydrochloride |
| SMILES | Cc1cccc(N/N=C(\c2ccccc2)c2ccc(Br)cc2)c1C.Cl |
| InChI | InChI=1S/C21H19BrN2.ClH/c1-15-7-6-10-20(16(15)2)23-24-21(17-8-4-3-5-9-17)18-11-13-19(22)14-12-18;/h3-14,23H,1-2H3;1H/b24-21+; |
| InChIKey | BNPKQNYITNMSOG-BBCFSJFZSA-N |
| XLogP | 6.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.76 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|