C17H14BrN3O — CID 177341576
(1E)-2-(4-bromophenyl)-N-(2,3-dimethylanilino)-2-oxoethanimidoyl cyanide (PubChem CID 177341576) has the molecular formula C17H14BrN3O and a molecular weight of 356.22 g/mol. Its IUPAC name is (1E)-2-(4-bromophenyl)-N-(2,3-dimethylanilino)-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-2-(4-bromophenyl)-N-(2,3-dimethylanilino)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 177341576 |
| Molecular Formula | C17H14BrN3O |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | (1E)-2-(4-bromophenyl)-N-(2,3-dimethylanilino)-2-oxoethanimidoyl cyanide |
| SMILES | Cc1cccc(N/N=C(\C#N)C(=O)c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C17H14BrN3O/c1-11-4-3-5-15(12(11)2)20-21-16(10-19)17(22)13-6-8-14(18)9-7-13/h3-9,20H,1-2H3/b21-16+ |
| InChIKey | ZWKCTOFXIMNZIA-LTGZKZEYSA-N |
| XLogP | 4.24 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|