C15H14F2N2 — CID 9014574
N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]-2-methylaniline (PubChem CID 9014574) has the molecular formula C15H14F2N2 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]-2-methylaniline.
| Compound Name | N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]-2-methylaniline |
|---|---|
| PubChem CID | 9014574 |
| Molecular Formula | C15H14F2N2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]-2-methylaniline |
| SMILES | C/C(=N/Nc1ccccc1C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H14F2N2/c1-10-5-3-4-6-15(10)19-18-11(2)12-7-8-13(16)14(17)9-12/h3-9,19H,1-2H3/b18-11- |
| InChIKey | AEBFVEDSZZZXDP-WQRHYEAKSA-N |
| XLogP | 4.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|