C17H18ClN3S — CID 3274900
1-[1-(4-chlorophenyl)ethylideneamino]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 3274900) has the molecular formula C17H18ClN3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethylideneamino]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[1-(4-chlorophenyl)ethylideneamino]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 3274900 |
| Molecular Formula | C17H18ClN3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethylideneamino]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | CC(=NNC(=S)Nc1cccc(C)c1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3S/c1-11-5-4-6-16(12(11)2)19-17(22)21-20-13(3)14-7-9-15(18)10-8-14/h4-10H,1-3H3,(H2,19,21,22) |
| InChIKey | QMCRJNLQAIXBHD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|