C16H25N3S — CID 18206200
1-(2,3-dimethylphenyl)-3-(heptan-4-ylideneamino)thiourea (PubChem CID 18206200) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-(heptan-4-ylideneamino)thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-(heptan-4-ylideneamino)thiourea |
|---|---|
| PubChem CID | 18206200 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-(heptan-4-ylideneamino)thiourea |
| SMILES | CCCC(CCC)=NNC(=S)Nc1cccc(C)c1C |
| InChI | InChI=1S/C16H25N3S/c1-5-8-14(9-6-2)18-19-16(20)17-15-11-7-10-12(3)13(15)4/h7,10-11H,5-6,8-9H2,1-4H3,(H2,17,19,20) |
| InChIKey | GSSAHLUHPBVTPC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|