C21H22N2S — CID 8657853
1-(2,3-dimethylphenyl)-3-[(1R)-1-naphthalen-1-ylethyl]thiourea (PubChem CID 8657853) has the molecular formula C21H22N2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(1R)-1-naphthalen-1-ylethyl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(1R)-1-naphthalen-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 8657853 |
| Molecular Formula | C21H22N2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(1R)-1-naphthalen-1-ylethyl]thiourea |
| SMILES | Cc1cccc(NC(=S)N[C@H](C)c2cccc3ccccc23)c1C |
| InChI | InChI=1S/C21H22N2S/c1-14-8-6-13-20(15(14)2)23-21(24)22-16(3)18-12-7-10-17-9-4-5-11-19(17)18/h4-13,16H,1-3H3,(H2,22,23,24)/t16-/m1/s1 |
| InChIKey | OAKJWUQWVLWZDC-MRXNPFEDSA-N |
| XLogP | 5.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|