C19H21F2N3OS — CID 5015170
1-[1-[4-(difluoromethoxy)phenyl]propylideneamino]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 5015170) has the molecular formula C19H21F2N3OS and a molecular weight of 377.46 g/mol. Its IUPAC name is 1-[1-[4-(difluoromethoxy)phenyl]propylideneamino]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[1-[4-(difluoromethoxy)phenyl]propylideneamino]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 5015170 |
| Molecular Formula | C19H21F2N3OS |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-[1-[4-(difluoromethoxy)phenyl]propylideneamino]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | CCC(=NNC(=S)Nc1cccc(C)c1C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H21F2N3OS/c1-4-16(14-8-10-15(11-9-14)25-18(20)21)23-24-19(26)22-17-7-5-6-12(2)13(17)3/h5-11,18H,4H2,1-3H3,(H2,22,24,26) |
| InChIKey | XQXKRCDQAZTCNU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|