C17H15F4N3S — CID 7612887
1-[(Z)-1-(4-fluorophenyl)propylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 7612887) has the molecular formula C17H15F4N3S and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-[(Z)-1-(4-fluorophenyl)propylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(Z)-1-(4-fluorophenyl)propylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 7612887 |
| Molecular Formula | C17H15F4N3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 1-[(Z)-1-(4-fluorophenyl)propylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC/C(=N/NC(=S)Nc1ccccc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F4N3S/c1-2-14(11-7-9-12(18)10-8-11)23-24-16(25)22-15-6-4-3-5-13(15)17(19,20)21/h3-10H,2H2,1H3,(H2,22,24,25)/b23-14- |
| InChIKey | LGOVUOXOQCLEIY-UCQKPKSFSA-N |
| XLogP | 4.95 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|