C10H12F3N3S — CID 18289668
1-ethyl-3-[2-(trifluoromethyl)anilino]thiourea (PubChem CID 18289668) has the molecular formula C10H12F3N3S and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-ethyl-3-[2-(trifluoromethyl)anilino]thiourea.
| Compound Name | 1-ethyl-3-[2-(trifluoromethyl)anilino]thiourea |
|---|---|
| PubChem CID | 18289668 |
| Molecular Formula | C10H12F3N3S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-ethyl-3-[2-(trifluoromethyl)anilino]thiourea |
| SMILES | CCNC(=S)NNc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H12F3N3S/c1-2-14-9(17)16-15-8-6-4-3-5-7(8)10(11,12)13/h3-6,15H,2H2,1H3,(H2,14,16,17) |
| InChIKey | INCCLFMCIGQDSX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|