C16H23F3N2S — CID 17284648
1,1-di(butan-2-yl)-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 17284648) has the molecular formula C16H23F3N2S and a molecular weight of 332.44 g/mol. Its IUPAC name is 1,1-di(butan-2-yl)-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1,1-di(butan-2-yl)-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17284648 |
| Molecular Formula | C16H23F3N2S |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1,1-di(butan-2-yl)-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | CCC(C)N(C(=S)Nc1ccccc1C(F)(F)F)C(C)CC |
| InChI | InChI=1S/C16H23F3N2S/c1-5-11(3)21(12(4)6-2)15(22)20-14-10-8-7-9-13(14)16(17,18)19/h7-12H,5-6H2,1-4H3,(H,20,22) |
| InChIKey | GUYNRGIUIJAUQY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|