C18H20F3N3 — CID 25018844
N'-(2-phenylethyl)-N-[2-(trifluoromethyl)anilino]propanimidamide (PubChem CID 25018844) has the molecular formula C18H20F3N3 and a molecular weight of 335.37 g/mol. Its IUPAC name is N'-(2-phenylethyl)-N-[2-(trifluoromethyl)anilino]propanimidamide.
| Compound Name | N'-(2-phenylethyl)-N-[2-(trifluoromethyl)anilino]propanimidamide |
|---|---|
| PubChem CID | 25018844 |
| Molecular Formula | C18H20F3N3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N'-(2-phenylethyl)-N-[2-(trifluoromethyl)anilino]propanimidamide |
| SMILES | CC/C(=N\CCc1ccccc1)NNc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H20F3N3/c1-2-17(22-13-12-14-8-4-3-5-9-14)24-23-16-11-7-6-10-15(16)18(19,20)21/h3-11,23H,2,12-13H2,1H3,(H,22,24) |
| InChIKey | VCZHZVXRJZABRT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|