C21H24F3N3O2 — CID 42703737
3-methyl-N-(2-phenylethyl)-2-[[2-(trifluoromethyl)phenyl]carbamoylamino]butanamide (PubChem CID 42703737) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 3-methyl-N-(2-phenylethyl)-2-[[2-(trifluoromethyl)phenyl]carbamoylamino]butanamide.
| Compound Name | 3-methyl-N-(2-phenylethyl)-2-[[2-(trifluoromethyl)phenyl]carbamoylamino]butanamide |
|---|---|
| PubChem CID | 42703737 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-methyl-N-(2-phenylethyl)-2-[[2-(trifluoromethyl)phenyl]carbamoylamino]butanamide |
| SMILES | CC(C)C(NC(=O)Nc1ccccc1C(F)(F)F)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H24F3N3O2/c1-14(2)18(19(28)25-13-12-15-8-4-3-5-9-15)27-20(29)26-17-11-7-6-10-16(17)21(22,23)24/h3-11,14,18H,12-13H2,1-2H3,(H,25,28)(H2,26,27,29) |
| InChIKey | YGOFOQXIGXCVIO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |