C20H24FN3O2 — CID 32934158
(2R)-N-[2-(3-fluorophenyl)ethyl]-3-methyl-2-(phenylcarbamoylamino)butanamide (PubChem CID 32934158) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is (2R)-N-[2-(3-fluorophenyl)ethyl]-3-methyl-2-(phenylcarbamoylamino)butanamide.
| Compound Name | (2R)-N-[2-(3-fluorophenyl)ethyl]-3-methyl-2-(phenylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 32934158 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2R)-N-[2-(3-fluorophenyl)ethyl]-3-methyl-2-(phenylcarbamoylamino)butanamide |
| SMILES | CC(C)[C@@H](NC(=O)Nc1ccccc1)C(=O)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C20H24FN3O2/c1-14(2)18(24-20(26)23-17-9-4-3-5-10-17)19(25)22-12-11-15-7-6-8-16(21)13-15/h3-10,13-14,18H,11-12H2,1-2H3,(H,22,25)(H2,23,24,26)/t18-/m1/s1 |
| InChIKey | SQZXMCVORKOWBD-GOSISDBHSA-N |
| XLogP | 3.33 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |