C18H19F2N3O2 — CID 134061504
N-(3,5-difluorophenyl)-3-methyl-2-(phenylcarbamoylamino)butanamide (PubChem CID 134061504) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-methyl-2-(phenylcarbamoylamino)butanamide.
| Compound Name | N-(3,5-difluorophenyl)-3-methyl-2-(phenylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 134061504 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-methyl-2-(phenylcarbamoylamino)butanamide |
| SMILES | CC(C)C(NC(=O)Nc1ccccc1)C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H19F2N3O2/c1-11(2)16(23-18(25)22-14-6-4-3-5-7-14)17(24)21-15-9-12(19)8-13(20)10-15/h3-11,16H,1-2H3,(H,21,24)(H2,22,23,25) |
| InChIKey | VJUVKKNEQWJXJE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |