C18H19F2N3OS — CID 6104719
1-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-3-(2,6-dimethylphenyl)thiourea (PubChem CID 6104719) has the molecular formula C18H19F2N3OS and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-3-(2,6-dimethylphenyl)thiourea.
| Compound Name | 1-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-3-(2,6-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 6104719 |
| Molecular Formula | C18H19F2N3OS |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-3-(2,6-dimethylphenyl)thiourea |
| SMILES | C/C(=N/NC(=S)Nc1c(C)cccc1C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H19F2N3OS/c1-11-5-4-6-12(2)16(11)21-18(25)23-22-13(3)14-7-9-15(10-8-14)24-17(19)20/h4-10,17H,1-3H3,(H2,21,23,25)/b22-13- |
| InChIKey | GZTVGAPEWMUGNA-XKZIYDEJSA-N |
| XLogP | 4.62 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|