C17H15F4N3O2S — CID 7933567
1-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)thiourea (PubChem CID 7933567) has the molecular formula C17H15F4N3O2S and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 7933567 |
| Molecular Formula | C17H15F4N3O2S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 1-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N/N=C\c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C17H15F4N3O2S/c1-10-4-2-3-5-13(10)23-17(27)24-22-9-11-6-7-12(25-15(18)19)8-14(11)26-16(20)21/h2-9,15-16H,1H3,(H2,23,24,27)/b22-9- |
| InChIKey | HUGVIFCGKLNQGC-AFPJDJCSSA-N |
| XLogP | 4.52 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|