C12H12F4N2O4 — CID 6905460
ethyl N-[(E)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]carbamate (PubChem CID 6905460) has the molecular formula C12H12F4N2O4 and a molecular weight of 324.23 g/mol. Its IUPAC name is ethyl N-[(E)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]carbamate.
| Compound Name | ethyl N-[(E)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 6905460 |
| Molecular Formula | C12H12F4N2O4 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | ethyl N-[(E)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C/c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C12H12F4N2O4/c1-2-20-12(19)18-17-6-7-3-4-8(21-10(13)14)5-9(7)22-11(15)16/h3-6,10-11H,2H2,1H3,(H,18,19)/b17-6+ |
| InChIKey | QXKVYRVMZVBDIR-UBKPWBPPSA-N |
| XLogP | 2.97 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|