C14H16F4N2O4 — CID 6905642
tert-butyl N-[(E)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]carbamate (PubChem CID 6905642) has the molecular formula C14H16F4N2O4 and a molecular weight of 352.28 g/mol. Its IUPAC name is tert-butyl N-[(E)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 6905642 |
| Molecular Formula | C14H16F4N2O4 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | tert-butyl N-[(E)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C/c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C14H16F4N2O4/c1-14(2,3)24-13(21)20-19-7-8-4-5-9(22-11(15)16)6-10(8)23-12(17)18/h4-7,11-12H,1-3H3,(H,20,21)/b19-7+ |
| InChIKey | RKAKYLAVMBPNPX-FBCYGCLPSA-N |
| XLogP | 3.75 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|