C16H18N2O3 — CID 136898949
tert-butyl N-[(Z)-(1-hydroxynaphthalen-2-yl)methylideneamino]carbamate (PubChem CID 136898949) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is tert-butyl N-[(Z)-(1-hydroxynaphthalen-2-yl)methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-(1-hydroxynaphthalen-2-yl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 136898949 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | tert-butyl N-[(Z)-(1-hydroxynaphthalen-2-yl)methylideneamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C\c1ccc2ccccc2c1O |
| InChI | InChI=1S/C16H18N2O3/c1-16(2,3)21-15(20)18-17-10-12-9-8-11-6-4-5-7-13(11)14(12)19/h4-10,19H,1-3H3,(H,18,20)/b17-10- |
| InChIKey | PBLUUPBKLDCSJP-YVLHZVERSA-N |
| XLogP | 3.40 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|