C12H12F4N2O4 — CID 6168777
methyl N-[(Z)-1-[2,4-bis(difluoromethoxy)phenyl]ethylideneamino]carbamate (PubChem CID 6168777) has the molecular formula C12H12F4N2O4 and a molecular weight of 324.23 g/mol. Its IUPAC name is methyl N-[(Z)-1-[2,4-bis(difluoromethoxy)phenyl]ethylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-1-[2,4-bis(difluoromethoxy)phenyl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 6168777 |
| Molecular Formula | C12H12F4N2O4 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | methyl N-[(Z)-1-[2,4-bis(difluoromethoxy)phenyl]ethylideneamino]carbamate |
| SMILES | COC(=O)N/N=C(/C)c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C12H12F4N2O4/c1-6(17-18-12(19)20-2)8-4-3-7(21-10(13)14)5-9(8)22-11(15)16/h3-5,10-11H,1-2H3,(H,18,19)/b17-6- |
| InChIKey | UISRIIRFFBGTQB-FMQZQXMHSA-N |
| XLogP | 2.97 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|