C18H15F4N5O3 — CID 6258532
2-(benzotriazol-1-yl)-N-[(Z)-1-[2,4-bis(difluoromethoxy)phenyl]ethylideneamino]acetamide (PubChem CID 6258532) has the molecular formula C18H15F4N5O3 and a molecular weight of 425.34 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[(Z)-1-[2,4-bis(difluoromethoxy)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[(Z)-1-[2,4-bis(difluoromethoxy)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6258532 |
| Molecular Formula | C18H15F4N5O3 |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[(Z)-1-[2,4-bis(difluoromethoxy)phenyl]ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)Cn1nnc2ccccc21)c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C18H15F4N5O3/c1-10(12-7-6-11(29-17(19)20)8-15(12)30-18(21)22)23-25-16(28)9-27-14-5-3-2-4-13(14)24-26-27/h2-8,17-18H,9H2,1H3,(H,25,28)/b23-10- |
| InChIKey | LAUBKWDPFPGIMO-RMORIDSASA-N |
| XLogP | 3.17 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|