C15H20F2N2O3 — CID 9074714
tert-butyl N-[(Z)-[4-(difluoromethoxy)-3,5-dimethylphenyl]methylideneamino]carbamate (PubChem CID 9074714) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is tert-butyl N-[(Z)-[4-(difluoromethoxy)-3,5-dimethylphenyl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-[4-(difluoromethoxy)-3,5-dimethylphenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 9074714 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | tert-butyl N-[(Z)-[4-(difluoromethoxy)-3,5-dimethylphenyl]methylideneamino]carbamate |
| SMILES | Cc1cc(/C=N\NC(=O)OC(C)(C)C)cc(C)c1OC(F)F |
| InChI | InChI=1S/C15H20F2N2O3/c1-9-6-11(7-10(2)12(9)21-13(16)17)8-18-19-14(20)22-15(3,4)5/h6-8,13H,1-5H3,(H,19,20)/b18-8- |
| InChIKey | WBSLMGZBIFSYLE-LSCVHKIXSA-N |
| XLogP | 3.76 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|