C12H14F2N2O2 — CID 59016011
tert-butyl N-[(E)-(3,5-difluorophenyl)methylideneamino]carbamate (PubChem CID 59016011) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is tert-butyl N-[(E)-(3,5-difluorophenyl)methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-(3,5-difluorophenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 59016011 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | tert-butyl N-[(E)-(3,5-difluorophenyl)methylideneamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C/c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H14F2N2O2/c1-12(2,3)18-11(17)16-15-7-8-4-9(13)6-10(14)5-8/h4-7H,1-3H3,(H,16,17)/b15-7+ |
| InChIKey | YVJCKFUOCUVVBQ-VIZOYTHASA-N |
| XLogP | 2.82 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|