C14H10Cl4N2 — CID 4291691
2,4,6-trichloro-N-[1-(4-chlorophenyl)ethylideneamino]aniline (PubChem CID 4291691) has the molecular formula C14H10Cl4N2 and a molecular weight of 348.06 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[1-(4-chlorophenyl)ethylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[1-(4-chlorophenyl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 4291691 |
| Molecular Formula | C14H10Cl4N2 |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2,4,6-trichloro-N-[1-(4-chlorophenyl)ethylideneamino]aniline |
| SMILES | CC(=NNc1c(Cl)cc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10Cl4N2/c1-8(9-2-4-10(15)5-3-9)19-20-14-12(17)6-11(16)7-13(14)18/h2-7,20H,1H3 |
| InChIKey | NQTOBYSEJRIWBH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|