C10H9Cl3N2O2 — CID 6323872
methyl (2Z)-2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanoate (PubChem CID 6323872) has the molecular formula C10H9Cl3N2O2 and a molecular weight of 295.55 g/mol. Its IUPAC name is methyl (2Z)-2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanoate.
| Compound Name | methyl (2Z)-2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 6323872 |
| Molecular Formula | C10H9Cl3N2O2 |
| Molecular Weight | 295.55 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | methyl (2Z)-2-[(2,4,6-trichlorophenyl)hydrazinylidene]propanoate |
| SMILES | COC(=O)/C(C)=N\Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl3N2O2/c1-5(10(16)17-2)14-15-9-7(12)3-6(11)4-8(9)13/h3-4,15H,1-2H3/b14-5- |
| InChIKey | ZSUPHRWAORTQEP-RZNTYIFUSA-N |
| XLogP | 3.61 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|