About methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate
methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate (PubChem CID 72791009) has the molecular formula C11H6Cl2F3N3O2
and a molecular weight of 340.09 g/mol. Its IUPAC name is methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate.
Molecular Properties
| Compound Name | methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate |
| PubChem CID | 72791009 |
| Molecular Formula | C11H6Cl2F3N3O2 |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate |
| SMILES | COC(=O)C(C#N)=NNc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H6Cl2F3N3O2/c1-21-10(20)8(4-17)18-19-9-6(12)2-5(3-7(9)13)11(14,15)16/h2-3,19H,1H3 |
| InChIKey | UZWPGAVSMQZSFX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate?
The IUPAC name of methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate (CID 72791009) is methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate.
What is the SMILES notation for methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate?
The canonical SMILES for methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate is COC(=O)C(C#N)=NNc1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate?
The InChIKey is UZWPGAVSMQZSFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2F3N3O2/c1-21-10(20)8(4-17)18-19-9-6(12)2-5(3-7(9)13)11(14,15)16/h2-3,19H,1H3.
What are the key properties of methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate?
methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate has a molecular weight of 340.09 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate is sourced from PubChem (CID 72791009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).