C11H6Cl2F3N3O2 — CID 72791009
methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate (PubChem CID 72791009) has the molecular formula C11H6Cl2F3N3O2 and a molecular weight of 340.09 g/mol. Its IUPAC name is methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate.
| Compound Name | methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 72791009 |
| Molecular Formula | C11H6Cl2F3N3O2 |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | methyl 2-cyano-2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]acetate |
| SMILES | COC(=O)C(C#N)=NNc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H6Cl2F3N3O2/c1-21-10(20)8(4-17)18-19-9-6(12)2-5(3-7(9)13)11(14,15)16/h2-3,19H,1H3 |
| InChIKey | UZWPGAVSMQZSFX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|