C12H11Cl2F3N2O2 — CID 169209861
methyl 2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]butanoate (PubChem CID 169209861) has the molecular formula C12H11Cl2F3N2O2 and a molecular weight of 343.13 g/mol. Its IUPAC name is methyl 2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]butanoate.
| Compound Name | methyl 2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 169209861 |
| Molecular Formula | C12H11Cl2F3N2O2 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | methyl 2-[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]butanoate |
| SMILES | CCC(=NNc1c(Cl)cc(C(F)(F)F)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C12H11Cl2F3N2O2/c1-3-9(11(20)21-2)18-19-10-7(13)4-6(5-8(10)14)12(15,16)17/h4-5,19H,3H2,1-2H3 |
| InChIKey | LEPLVAJQSJDBDG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|