C11H10Cl3F3N2O2 — CID 157203688
chloroethane;[2,6-dichloro-4-(trifluoromethyl)phenyl] 2-hydrazinylideneacetate (PubChem CID 157203688) has the molecular formula C11H10Cl3F3N2O2 and a molecular weight of 365.57 g/mol. Its IUPAC name is chloroethane;[2,6-dichloro-4-(trifluoromethyl)phenyl] 2-hydrazinylideneacetate.
| Compound Name | chloroethane;[2,6-dichloro-4-(trifluoromethyl)phenyl] 2-hydrazinylideneacetate |
|---|---|
| PubChem CID | 157203688 |
| Molecular Formula | C11H10Cl3F3N2O2 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | chloroethane;[2,6-dichloro-4-(trifluoromethyl)phenyl] 2-hydrazinylideneacetate |
| SMILES | CCCl.NN=CC(=O)Oc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H5Cl2F3N2O2.C2H5Cl/c10-5-1-4(9(12,13)14)2-6(11)8(5)18-7(17)3-16-15;1-2-3/h1-3H,15H2;2H2,1H3 |
| InChIKey | ARCDDTDKLGUYHZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|