C14H12Cl2F3N3O3 — CID 88953041
(1E)-1-[(E)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-3-en-2-ylidene]-3-(2-oxoethyl)urea (PubChem CID 88953041) has the molecular formula C14H12Cl2F3N3O3 and a molecular weight of 398.17 g/mol. Its IUPAC name is (1E)-1-[(E)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-3-en-2-ylidene]-3-(2-oxoethyl)urea.
| Compound Name | (1E)-1-[(E)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-3-en-2-ylidene]-3-(2-oxoethyl)urea |
|---|---|
| PubChem CID | 88953041 |
| Molecular Formula | C14H12Cl2F3N3O3 |
| Molecular Weight | 398.17 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | (1E)-1-[(E)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-3-en-2-ylidene]-3-(2-oxoethyl)urea |
| SMILES | CC(/C=C(\N)Oc1c(Cl)cc(C(F)(F)F)cc1Cl)=N\C(=O)NCC=O |
| InChI | InChI=1S/C14H12Cl2F3N3O3/c1-7(22-13(24)21-2-3-23)4-11(20)25-12-9(15)5-8(6-10(12)16)14(17,18)19/h3-6H,2,20H2,1H3,(H,21,24)/b11-4+,22-7+ |
| InChIKey | YBRQMOREYZOUMT-VVLHVPFLSA-N |
| XLogP | 3.56 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|