C11H9Cl2F3N2O2 — CID 54469910
methyl 3-[N-amino-2,6-dichloro-4-(trifluoromethyl)anilino]prop-2-enoate (PubChem CID 54469910) has the molecular formula C11H9Cl2F3N2O2 and a molecular weight of 329.11 g/mol. Its IUPAC name is methyl 3-[N-amino-2,6-dichloro-4-(trifluoromethyl)anilino]prop-2-enoate.
| Compound Name | methyl 3-[N-amino-2,6-dichloro-4-(trifluoromethyl)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 54469910 |
| Molecular Formula | C11H9Cl2F3N2O2 |
| Molecular Weight | 329.11 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | methyl 3-[N-amino-2,6-dichloro-4-(trifluoromethyl)anilino]prop-2-enoate |
| SMILES | COC(=O)C=CN(N)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H9Cl2F3N2O2/c1-20-9(19)2-3-18(17)10-7(12)4-6(5-8(10)13)11(14,15)16/h2-5H,17H2,1H3 |
| InChIKey | XHOVDXITRPFAOP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|