C11H9Cl2F3N2O2S — CID 67854010
N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanyl-2-oxopropanehydrazide (PubChem CID 67854010) has the molecular formula C11H9Cl2F3N2O2S and a molecular weight of 361.17 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanyl-2-oxopropanehydrazide.
| Compound Name | N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanyl-2-oxopropanehydrazide |
|---|---|
| PubChem CID | 67854010 |
| Molecular Formula | C11H9Cl2F3N2O2S |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanyl-2-oxopropanehydrazide |
| SMILES | CSCC(=O)C(=O)N(N)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H9Cl2F3N2O2S/c1-21-4-8(19)10(20)18(17)9-6(12)2-5(3-7(9)13)11(14,15)16/h2-3H,4,17H2,1H3 |
| InChIKey | NXDQUYQYXPIDKT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|